Isotretinoin, also known as 13-cis-retinoic acid, is an orally active vitamin A derivative primarily used for the treatment of severe acne. It is highly effective in reducing sebum production, preventing acne formation, and promoting skin healing.
Isotretinoin is also investigated for its anticancer properties, as it can induce apoptosis and inhibit cell proliferation in certain cancer cell lines. The compound is sensitive to air, heat, and light, requiring careful storage and handling.
Isotretinoin is metabolized in the body to active retinoids that bind to retinoic acid receptors (RARs) and retinoid X receptors (RXRs), modulating gene expression and cellular differentiation.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | 13-cis-Retinoic acid, Accutane, Claravis |
|---|---|
| IUPAC Name | (2Z, 4E, 6E, 8E)-3, 7-dimethyl-9-(2, 6, 6-trimethylcyclohexen-1-yl)nona-2, 4, 6, 8-tetraenoic acid |
| CAS | 4759-48-2 |
| Molecular Weight | 300.4 |
| Molecular Formula | C20H28O2 |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C\C(=O)O)/C)/C |