J147 is a potent, orally active neuroprotective agent designed for cognitive enhancement. It effectively crosses the blood-brain barrier (BBB) and inhibits monoamine oxidase B (MAO B) and the dopamine transporter. J147 has shown significant potential in addressing Alzheimer’s disease (AD) by reversing cognitive impairment in aged AD mice and providing immediate cognition benefits. It is also noted for its neurotrophic properties and safety in animal studies.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | j147, UNII-Z41H3C5BT9, Z41H3C5BT9 |
|---|---|
| IUPAC Name | N-(2, 4-dimethylphenyl)-2, 2, 2-trifluoro-N-[(E)-(3-methoxyphenyl)methylideneamino]acetamide |
| CAS | 1146963-51-0 |
| Molecular Weight | 350.3 |
| Molecular Formula | C18H17F3N2O2 |
| SMILES | CC1=CC(=C(C=C1)N(C(=O)C(F)(F)F)/N=C/C2=CC(=CC=C2)OC)C |