Epicatechin, a flavan-3-ol compound, is an antioxidant found abundantly in various foods and beverages, particularly in dark chocolate, green tea, and certain fruits.
Research indicates that epicatechin can enhance blood vessel function, improve insulin sensitivity, and exhibit anti-inflammatory effects, contributing to its role in reducing the risk of chronic diseases. The compound’s ability to modulate nitric oxide levels and promote vasodilation is particularly significant in supporting cardiovascular health.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
Other Names | (-)-Epicatechin, Epicatechin, Epicatechol |
---|---|
IUPAC Name | (2R, 3R)-2-(3, 4-dihydroxyphenyl)-3, 4-dihydro-2H-chromene-3, 5, 7-triol |
CAS | 490-46-0 |
Molecular Weight | 290.27 |
Molecular Formula | C15H14O6 |
SMILES | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |