N-Desmethyl Zopiclone Hydrochloride, is a chemical compound with the molecular formula C16H16Cl2N6O3 and a molecular weight of 411.2 g/mol. This compound is a derivative of N-Desmethylzopiclone, with the addition of a hydrochloride salt. It is characterized by its complex structure, featuring a chloropyridin-2-yl group, a pyrrolo[3,4-b]pyrazin-5-yl ring system, and a piperazine-1-carboxylate moiety.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | N-Desmethyl Zopiclone Hydrochloride, N-Desmethylzopiclone hydrochloride |
|---|---|
| IUPAC Name | [6-(5-chloropyridin-2-yl)-5-oxo-7H-pyrrolo[3, 4-b]pyrazin-7-yl] piperazine-1-carboxylate;hydrochloride |
| CAS | 1216659-29-8 |
| Molecular Weight | 411.2 |
| Molecular Formula | C16H16Cl2N6O3 |
| SMILES | C1CN(CCN1)C(=O)OC2C3=NC=CN=C3C(=O)N2C4=NC=C(C=C4)Cl.Cl |