Pramiracetam is a synthetic nootropic agent belonging to the racetam family, known for its cognitive-enhancing properties. Initially developed by Parke-Davis in the late 1970s, pramiracetam has been studied for its potential in improving memory and attention deficits, particularly in aging individuals with neurodegenerative and vascular dementias. The drug’s mechanism of action is believed to involve the enhancement of high-affinity choline uptake, which in turn increases acetylcholine levels, a neurotransmitter crucial for memory function.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Pramiracetam hydrochloride, Amacetam hydrochloride, Remen |
|---|---|
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide;hydrochloride |
| CAS | 75733-50-5 |
| Molecular Weight | 305.84 |
| Molecular Formula | C14H28ClN3O2 |
| SMILES | CC(C)N(CCNC(=O)CN1CCCC1=O)C(C)C.Cl |