Ractopamine is a beta-adrenergic agonist used as a feed additive to promote lean muscle growth and improve feed efficiency in livestock, particularly pigs, cattle, and turkeys.
It functions by stimulating beta-1 and beta-2 adrenergic receptors, enhancing protein synthesis and reducing fat deposition.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Ractopamine hydrochloride, El737, Optaflexx 45 |
|---|---|
| IUPAC Name | 4-[3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride |
| CAS | 90274-24-1 |
| Molecular Weight | 337.8 |
| Molecular Formula | C18H24ClNO3 |
| SMILES | CC(CCC1=CC=C(C=C1)O)NCC(C2=CC=C(C=C2)O)O.Cl |