The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Luteolin tetramethyl ether, 3’, 4', 5, 7-Tetramethoxyflavone |
|---|---|
| IUPAC Name | 2-(3, 4-dimethoxyphenyl)-5, 7-dimethoxychromen-4-one |
| CAS | 855-97-0 |
| Molecular Weight | 342.3 |
| Molecular Formula | C19H18O6 |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OC)OC |