S-23 – (1010396-29-8)

S-23 is a selective androgen receptor modulator (SARM), shown to induce androgen receptor-mediated transcriptional activation in CV-1 cells and increase the weights of androgen-dependent organs such as the prostate and seminal vesicles.

In terms of its potential applications, S-23 is being investigated for its anabolic effects, which include promoting lean muscle mass gain and fat loss. It enhances protein synthesis, leading to increased muscle hypertrophy and strength, and has been shown to reduce total fat mass by increasing the basal metabolic rate and promoting lipolysis. In a study on castrated male rats, S-23 significantly increased lean body mass and decreased fat mass over a 12-week period.

Despite its promising benefits, the safety profile of S-23 is still under investigation. Potential side effects include suppression of natural testosterone production, which can lead to hormonal imbalances and potential infertility. Users may also experience increased aggression, mood swings, and liver toxicity. The long-term effects on human health remain unclear, and more comprehensive human trials are needed to fully understand the safety implications of S-23 use.

The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.

S-23 is a selective androgen receptor modulator (SARM), shown to induce androgen receptor-mediated transcriptional activation in CV-1 cells and increase the weights of androgen-dependent organs such as the prostate and seminal vesicles.

In terms of its potential applications, S-23 is being investigated for its anabolic effects, which include promoting lean muscle mass gain and fat loss. It enhances protein synthesis, leading to increased muscle hypertrophy and strength, and has been shown to reduce total fat mass by increasing the basal metabolic rate and promoting lipolysis. In a study on castrated male rats, S-23 significantly increased lean body mass and decreased fat mass over a 12-week period.

Despite its promising benefits, the safety profile of S-23 is still under investigation. Potential side effects include suppression of natural testosterone production, which can lead to hormonal imbalances and potential infertility. Users may also experience increased aggression, mood swings, and liver toxicity. The long-term effects on human health remain unclear, and more comprehensive human trials are needed to fully understand the safety implications of S-23 use.

The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
Sources:
https://pubchem.ncbi.nlm.nih.gov/compound/24892822
https://www.medchemexpress.com/s-23.html
https://www.medkoo.com/products/41641

What is S23 SARM and is it safe?


https://medisearch.io/blog/s-23-sarm-benefits-and-side-effects

Other Names

CCTH-methylpropionamide

IUPAC Name

(2S)-3-(4-chloro-3-fluorophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide

CAS

1010396-29-8

Molecular Weight

416.8

Molecular Formula

C18H13ClF4N2O3

SMILES

C[C@](COC1=CC(=C(C=C1)Cl)F)(C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F)O

No products in the cart.