Noopept is a nootropic compound initially developed in Russia. It is a prodrug of the endogenous dipeptide cycloprolylglycine, which is believed to modulate AMPA receptors and exert neuroprotective effects.
Noopept has been studied for its potential in treating brain injuries and stroke, with research indicating antioxidant, anti-inflammatory, and neuroprotective properties. Despite its popularity as a cognitive enhancer, clinical evidence supporting its efficacy in humans is limited. Most studies have been conducted in animal models, with few human trials available.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | GVS-111, Omberacetam |
|---|---|
| IUPAC Name | ethyl 2-[[(2S)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]acetate |
| CAS | 157115-85-0 |
| Molecular Weight | 318.4 |
| Molecular Formula | C17H22N2O4 |
| SMILES | CCOC(=O)CNC(=O)[C@@H]1CCCN1C(=O)CC2=CC=CC=C2 |